1 Glacial acetic acid can produce the typical chemical reaction of common carboxylic acids, and at the same time can be reduced to ethanol, acetyl chloride can be generated through the nucleophilic substitution mechanism, or bimolecular dehydration to generate acid anhydride.
Typical chemical reaction of acetic acid:
Acetic acid and sodium carbonate: 2CH3COOH+Na2CO3==2CH3COONa+CO2↑+H2O
Acetic acid and calcium carbonate: 2CH3COOH+CaCO3==(CH3COO)2Ca+CO2↑+H2O
Acetic acid and sodium bicarbonate: NaHCO3+CH3COOH==CH3COONa+H2O+CO2↑
The reaction of acetic acid and alkali: CH3COOH+OH-==CH3COO-+H2O
The reaction of acetic acid and weak acid salt: 2CH3COOH+CO32-==2CH3COO-+H2O+CO2↑
The reaction of acetic acid and active metal element: Fe+2CH3COOH==(CH3COO)2Fe+H2↑
Zn+2CH3COOH==（CH3COO）2Zn +H2↑
2Na+2CH3COOH==2CH3COONa+H2↑
The reaction of acetic acid and zinc oxide: 2CH3COOH+ZnO==(CH3COO)2Zn+H2O